About piperidine;sulfonylurea
piperidine;sulfonylurea (PubChem CID 158107137) has the molecular formula C6H13N3O3S
and a molecular weight of 207.25 g/mol. Its IUPAC name is piperidine;sulfonylurea.
Molecular Properties
| Compound Name | piperidine;sulfonylurea |
| PubChem CID | 158107137 |
| Molecular Formula | C6H13N3O3S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | piperidine;sulfonylurea |
| SMILES | C1CCNCC1.NC(=O)N=S(=O)=O |
| InChI | InChI=1S/C5H11N.CH2N2O3S/c1-2-4-6-5-3-1;2-1(4)3-7(5)6/h6H,1-5H2;(H2,2,4) |
| InChIKey | FPYZYVOKXDWGRZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidine;sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;sulfonylurea?
The IUPAC name of piperidine;sulfonylurea (CID 158107137) is piperidine;sulfonylurea.
What is the SMILES notation for piperidine;sulfonylurea?
The canonical SMILES for piperidine;sulfonylurea is C1CCNCC1.NC(=O)N=S(=O)=O.
What is the InChIKey of piperidine;sulfonylurea?
The InChIKey is FPYZYVOKXDWGRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.CH2N2O3S/c1-2-4-6-5-3-1;2-1(4)3-7(5)6/h6H,1-5H2;(H2,2,4).
What are the key properties of piperidine;sulfonylurea?
piperidine;sulfonylurea has a molecular weight of 207.25 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;sulfonylurea is sourced from PubChem (CID 158107137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).