About CID 15810753
CID 15810753 (PubChem CID 15810753) has the molecular formula C11H19Si
and a molecular weight of 179.36 g/mol.
Molecular Properties
| Compound Name | CID 15810753 |
| PubChem CID | 15810753 |
| Molecular Formula | C11H19Si |
| Molecular Weight | 179.36 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)C([Si](C)C)=C1C |
| InChI | InChI=1S/C11H19Si/c1-7-8(2)10(4)11(9(7)3)12(5)6/h9H,1-6H3 |
| InChIKey | VLFHQIWTQMVABJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 15810753 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15810753?
The IUPAC name of CID 15810753 (CID 15810753) is not available.
What is the SMILES notation for CID 15810753?
The canonical SMILES for CID 15810753 is CC1=C(C)C(C)C([Si](C)C)=C1C.
What is the InChIKey of CID 15810753?
The InChIKey is VLFHQIWTQMVABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19Si/c1-7-8(2)10(4)11(9(7)3)12(5)6/h9H,1-6H3.
What are the key properties of CID 15810753?
CID 15810753 has a molecular weight of 179.36 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15810753 is sourced from PubChem (CID 15810753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).