C18H11Br3F4 — CID 158107817
4-bromo-1,1-difluoroindene;2,7-dibromo-3,3-difluoro-1,2-dihydroindene (PubChem CID 158107817) has the molecular formula C18H11Br3F4 and a molecular weight of 542.99 g/mol. Its IUPAC name is 4-bromo-1,1-difluoroindene;2,7-dibromo-3,3-difluoro-1,2-dihydroindene.
| Compound Name | 4-bromo-1,1-difluoroindene;2,7-dibromo-3,3-difluoro-1,2-dihydroindene |
|---|---|
| PubChem CID | 158107817 |
| Molecular Formula | C18H11Br3F4 |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 539.83 |
| IUPAC Name | 4-bromo-1,1-difluoroindene;2,7-dibromo-3,3-difluoro-1,2-dihydroindene |
| SMILES | FC1(F)C=Cc2c(Br)cccc21.FC1(F)c2cccc(Br)c2CC1Br |
| InChI | InChI=1S/C9H6Br2F2.C9H5BrF2/c10-7-3-1-2-6-5(7)4-8(11)9(6,12)13;10-8-3-1-2-7-6(8)4-5-9(7,11)12/h1-3,8H,4H2;1-5H |
| InChIKey | FQBBWXPKMNKOMA-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|