About 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid
4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid (PubChem CID 158108095) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid |
| PubChem CID | 158108095 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCNCCCC(=O)O |
| InChI | InChI=1S/C6H13NO2.C4H6O2/c1-2-7-5-3-4-6(8)9;1-3(2)4(5)6/h7H,2-5H2,1H3,(H,8,9);1H2,2H3,(H,5,6) |
| InChIKey | FQBVDKHWCNTPFR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid?
The IUPAC name of 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid (CID 158108095) is 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid.
What is the SMILES notation for 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid?
The canonical SMILES for 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCNCCCC(=O)O.
What is the InChIKey of 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid?
The InChIKey is FQBVDKHWCNTPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C4H6O2/c1-2-7-5-3-4-6(8)9;1-3(2)4(5)6/h7H,2-5H2,1H3,(H,8,9);1H2,2H3,(H,5,6).
What are the key properties of 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid?
4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid has a molecular weight of 217.26 g/mol, XLogP of 1.11, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)butanoic acid;2-methylprop-2-enoic acid is sourced from PubChem (CID 158108095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).