About 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium
1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium (PubChem CID 158108447) has the molecular formula C26H25N2+
and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium.
Molecular Properties
| Compound Name | 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium |
| PubChem CID | 158108447 |
| Molecular Formula | C26H25N2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)c1-n1cc[n+]2c1-c1ccccc1C2 |
| InChI | InChI=1S/C26H25N2/c1-3-19-16-23(21-10-6-5-7-11-21)17-20(4-2)25(19)28-15-14-27-18-22-12-8-9-13-24(22)26(27)28/h5-17H,3-4,18H2,1-2H3/q+1 |
| InChIKey | LAEHKSUYOSTEDS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium?
The IUPAC name of 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium (CID 158108447) is 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium.
What is the SMILES notation for 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium?
The canonical SMILES for 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium is CCc1cc(-c2ccccc2)cc(CC)c1-n1cc[n+]2c1-c1ccccc1C2.
What is the InChIKey of 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium?
The InChIKey is LAEHKSUYOSTEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N2/c1-3-19-16-23(21-10-6-5-7-11-21)17-20(4-2)25(19)28-15-14-27-18-22-12-8-9-13-24(22)26(27)28/h5-17H,3-4,18H2,1-2H3/q+1.
What are the key properties of 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium?
1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium has a molecular weight of 365.50 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-diethyl-4-phenylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium is sourced from PubChem (CID 158108447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).