About 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one
4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one (PubChem CID 158110382) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one |
| PubChem CID | 158110382 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one |
| SMILES | C1=NCCN1.CN1CCCC1=O |
| InChI | InChI=1S/C5H9NO.C3H6N2/c1-6-4-2-3-5(6)7;1-2-5-3-4-1/h2-4H2,1H3;3H,1-2H2,(H,4,5) |
| InChIKey | FQIXVQJJZLCMDQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one?
The IUPAC name of 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one (CID 158110382) is 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one.
What is the SMILES notation for 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one?
The canonical SMILES for 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one is C1=NCCN1.CN1CCCC1=O.
What is the InChIKey of 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one?
The InChIKey is FQIXVQJJZLCMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H6N2/c1-6-4-2-3-5(6)7;1-2-5-3-4-1/h2-4H2,1H3;3H,1-2H2,(H,4,5).
What are the key properties of 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one?
4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one has a molecular weight of 169.23 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazole;1-methylpyrrolidin-2-one is sourced from PubChem (CID 158110382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).