C32H28BF6N7O5 — CID 158111971
1-pyridin-2-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide;1-pyridin-2-yl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 158111971) has the molecular formula C32H28BF6N7O5 and a molecular weight of 715.42 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide;1-pyridin-2-yl-3-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-pyridin-2-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide;1-pyridin-2-yl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158111971 |
| Molecular Formula | C32H28BF6N7O5 |
| Molecular Weight | 715.42 g/mol |
| Exact Mass | 715.21 |
| IUPAC Name | 1-pyridin-2-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide;1-pyridin-2-yl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(NC(=O)c3cn(-c4ccccn4)nc3C(F)(F)F)cc2)OC1(C)C.O=C(O)c1cn(-c2ccccn2)nc1C(F)(F)F |
| InChI | InChI=1S/C22H22BF3N4O3.C10H6F3N3O2/c1-20(2)21(3,4)33-23(32-20)14-8-10-15(11-9-14)28-19(31)16-13-30(17-7-5-6-12-27-17)29-18(16)22(24,25)26;11-10(12,13)8-6(9(17)18)5-16(15-8)7-3-1-2-4-14-7/h5-13H,1-4H3,(H,28,31);1-5H,(H,17,18) |
| InChIKey | FQNVOXNRZANYPR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|