C12H15BrF6O4 — CID 158112939
(2-bromo-4,4,4-trifluorobutyl) acetate;[(Z)-4,4,4-trifluorobut-2-enyl] acetate (PubChem CID 158112939) has the molecular formula C12H15BrF6O4 and a molecular weight of 417.14 g/mol. Its IUPAC name is (2-bromo-4,4,4-trifluorobutyl) acetate;[(Z)-4,4,4-trifluorobut-2-enyl] acetate.
| Compound Name | (2-bromo-4,4,4-trifluorobutyl) acetate;[(Z)-4,4,4-trifluorobut-2-enyl] acetate |
|---|---|
| PubChem CID | 158112939 |
| Molecular Formula | C12H15BrF6O4 |
| Molecular Weight | 417.14 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | (2-bromo-4,4,4-trifluorobutyl) acetate;[(Z)-4,4,4-trifluorobut-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C\C(F)(F)F.CC(=O)OCC(Br)CC(F)(F)F |
| InChI | InChI=1S/C6H8BrF3O2.C6H7F3O2/c1-4(11)12-3-5(7)2-6(8,9)10;1-5(10)11-4-2-3-6(7,8)9/h5H,2-3H2,1H3;2-3H,4H2,1H3/b;3-2- |
| InChIKey | FQQUNDQQUPXUBJ-AHNKWOMYSA-N |
| XLogP | 3.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|