About 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate
1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate (PubChem CID 158113451) has the molecular formula C12H16ClO4P
and a molecular weight of 290.68 g/mol. Its IUPAC name is 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate.
Molecular Properties
| Compound Name | 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate |
| PubChem CID | 158113451 |
| Molecular Formula | C12H16ClO4P |
| Molecular Weight | 290.68 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate |
| SMILES | CC(Cl)OC(=O)Cc1ccc(OP(C)(C)=O)cc1 |
| InChI | InChI=1S/C12H16ClO4P/c1-9(13)16-12(14)8-10-4-6-11(7-5-10)17-18(2,3)15/h4-7,9H,8H2,1-3H3 |
| InChIKey | ZMHWJCFFBIZBRD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate?
The IUPAC name of 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate (CID 158113451) is 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate.
What is the SMILES notation for 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate?
The canonical SMILES for 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate is CC(Cl)OC(=O)Cc1ccc(OP(C)(C)=O)cc1.
What is the InChIKey of 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate?
The InChIKey is ZMHWJCFFBIZBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClO4P/c1-9(13)16-12(14)8-10-4-6-11(7-5-10)17-18(2,3)15/h4-7,9H,8H2,1-3H3.
What are the key properties of 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate?
1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate has a molecular weight of 290.68 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl 2-(4-dimethylphosphoryloxyphenyl)acetate is sourced from PubChem (CID 158113451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).