About 1,3-di(propan-2-yl)pyrrolidin-2-one;methane
1,3-di(propan-2-yl)pyrrolidin-2-one;methane (PubChem CID 158114726) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)pyrrolidin-2-one;methane.
Molecular Properties
| Compound Name | 1,3-di(propan-2-yl)pyrrolidin-2-one;methane |
| PubChem CID | 158114726 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1,3-di(propan-2-yl)pyrrolidin-2-one;methane |
| SMILES | C.CC(C)C1CCN(C(C)C)C1=O |
| InChI | InChI=1S/C10H19NO.CH4/c1-7(2)9-5-6-11(8(3)4)10(9)12;/h7-9H,5-6H2,1-4H3;1H4 |
| InChIKey | FQVZBURDJAPWIJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-di(propan-2-yl)pyrrolidin-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(propan-2-yl)pyrrolidin-2-one;methane?
The IUPAC name of 1,3-di(propan-2-yl)pyrrolidin-2-one;methane (CID 158114726) is 1,3-di(propan-2-yl)pyrrolidin-2-one;methane.
What is the SMILES notation for 1,3-di(propan-2-yl)pyrrolidin-2-one;methane?
The canonical SMILES for 1,3-di(propan-2-yl)pyrrolidin-2-one;methane is C.CC(C)C1CCN(C(C)C)C1=O.
What is the InChIKey of 1,3-di(propan-2-yl)pyrrolidin-2-one;methane?
The InChIKey is FQVZBURDJAPWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.CH4/c1-7(2)9-5-6-11(8(3)4)10(9)12;/h7-9H,5-6H2,1-4H3;1H4.
What are the key properties of 1,3-di(propan-2-yl)pyrrolidin-2-one;methane?
1,3-di(propan-2-yl)pyrrolidin-2-one;methane has a molecular weight of 185.31 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(propan-2-yl)pyrrolidin-2-one;methane is sourced from PubChem (CID 158114726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).