C7H14N2 — CID 15811480
(1R,6S)-6-(aminomethyl)cyclohex-3-en-1-amine (PubChem CID 15811480) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1R,6S)-6-(aminomethyl)cyclohex-3-en-1-amine.
| Compound Name | (1R,6S)-6-(aminomethyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 15811480 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1R,6S)-6-(aminomethyl)cyclohex-3-en-1-amine |
| SMILES | NC[C@@H]1CC=CC[C@H]1N |
| InChI | InChI=1S/C7H14N2/c8-5-6-3-1-2-4-7(6)9/h1-2,6-7H,3-5,8-9H2/t6-,7+/m0/s1 |
| InChIKey | JDSRZTSRTLZLQW-NKWVEPMBSA-N |
| XLogP | 0.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|