C40H48BBrO10S2 — CID 158115174
2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethyl 4-(5-bromo-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethyl 4-(5-ethenyl-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate (PubChem CID 158115174) has the molecular formula C40H48BBrO10S2 and a molecular weight of 843.66 g/mol. Its IUPAC name is 2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethyl 4-(5-bromo-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethyl 4-(5-ethenyl-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate.
| Compound Name | 2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethyl 4-(5-bromo-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethyl 4-(5-ethenyl-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 158115174 |
| Molecular Formula | C40H48BBrO10S2 |
| Molecular Weight | 843.66 g/mol |
| Exact Mass | 842.20 |
| IUPAC Name | 2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethyl 4-(5-bromo-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethyl 4-(5-ethenyl-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate |
| SMILES | C=CB1OC(C)(C)C(C)(C)O1.C=Cc1cc2cc(C(=O)CCC(=O)OCC)sc2cc1OC.CCOC(=O)CCC(=O)c1cc2cc(Br)c(OC)cc2s1 |
| InChI | InChI=1S/C17H18O4S.C15H15BrO4S.C8H15BO2/c1-4-11-8-12-9-16(22-15(12)10-14(11)20-3)13(18)6-7-17(19)21-5-2;1-3-20-15(18)5-4-11(17)14-7-9-6-10(16)12(19-2)8-13(9)21-14;1-6-9-10-7(2,3)8(4,5)11-9/h4,8-10H,1,5-7H2,2-3H3;6-8H,3-5H2,1-2H3;6H,1H2,2-5H3 |
| InChIKey | FQXIHWUUVUQKBU-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.66 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|