C31H24Cl2F3N3O4 — CID 158115274
2,4-dichloro-7-methoxyquinoline;2,4-difluoro-7-methoxyquinoline;4-fluoro-2,7-dimethoxyquinoline (PubChem CID 158115274) has the molecular formula C31H24Cl2F3N3O4 and a molecular weight of 630.45 g/mol. Its IUPAC name is 2,4-dichloro-7-methoxyquinoline;2,4-difluoro-7-methoxyquinoline;4-fluoro-2,7-dimethoxyquinoline.
| Compound Name | 2,4-dichloro-7-methoxyquinoline;2,4-difluoro-7-methoxyquinoline;4-fluoro-2,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 158115274 |
| Molecular Formula | C31H24Cl2F3N3O4 |
| Molecular Weight | 630.45 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | 2,4-dichloro-7-methoxyquinoline;2,4-difluoro-7-methoxyquinoline;4-fluoro-2,7-dimethoxyquinoline |
| SMILES | COc1ccc2c(Cl)cc(Cl)nc2c1.COc1ccc2c(F)cc(F)nc2c1.COc1ccc2c(F)cc(OC)nc2c1 |
| InChI | InChI=1S/C11H10FNO2.C10H7Cl2NO.C10H7F2NO/c1-14-7-3-4-8-9(12)6-11(15-2)13-10(8)5-7;2*1-14-6-2-3-7-8(11)5-10(12)13-9(7)4-6/h3-6H,1-2H3;2*2-5H,1H3 |
| InChIKey | FQXQSUCZKWSFCR-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.45 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|