About 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one
3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one (PubChem CID 158117388) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one.
Molecular Properties
| Compound Name | 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one |
| PubChem CID | 158117388 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one |
| SMILES | C=C1CCOC1=O.CCC1(C)CCOC1=O |
| InChI | InChI=1S/C7H12O2.C5H6O2/c1-3-7(2)4-5-9-6(7)8;1-4-2-3-7-5(4)6/h3-5H2,1-2H3;1-3H2 |
| InChIKey | FREHWUDPNOGOQB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one?
The IUPAC name of 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one (CID 158117388) is 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one.
What is the SMILES notation for 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one?
The canonical SMILES for 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one is C=C1CCOC1=O.CCC1(C)CCOC1=O.
What is the InChIKey of 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one?
The InChIKey is FREHWUDPNOGOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C5H6O2/c1-3-7(2)4-5-9-6(7)8;1-4-2-3-7-5(4)6/h3-5H2,1-2H3;1-3H2.
What are the key properties of 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one?
3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one has a molecular weight of 226.27 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methyloxolan-2-one;3-methylideneoxolan-2-one is sourced from PubChem (CID 158117388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).