C22H30N4O4 — CID 158117600
(2S,5R)-7-oxo-6-phenylmethoxy-N-(1-prop-1-en-2-ylpiperidin-4-yl)oxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 158117600) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2S,5R)-7-oxo-6-phenylmethoxy-N-(1-prop-1-en-2-ylpiperidin-4-yl)oxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,5R)-7-oxo-6-phenylmethoxy-N-(1-prop-1-en-2-ylpiperidin-4-yl)oxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 158117600 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2S,5R)-7-oxo-6-phenylmethoxy-N-(1-prop-1-en-2-ylpiperidin-4-yl)oxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | C=C(C)N1CCC(ONC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O4/c1-16(2)24-12-10-19(11-13-24)30-23-21(27)20-9-8-18-14-25(20)22(28)26(18)29-15-17-6-4-3-5-7-17/h3-7,18-20H,1,8-15H2,2H3,(H,23,27)/t18-,20+/m1/s1 |
| InChIKey | LUHQHCZMYPEEKF-QUCCMNQESA-N |
| XLogP | 2.43 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|