C18H33O9P — CID 15811792
triethyl 3-diethoxyphosphorylpentane-1,3,5-tricarboxylate (PubChem CID 15811792) has the molecular formula C18H33O9P and a molecular weight of 424.43 g/mol. Its IUPAC name is triethyl 3-diethoxyphosphorylpentane-1,3,5-tricarboxylate.
| Compound Name | triethyl 3-diethoxyphosphorylpentane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 15811792 |
| Molecular Formula | C18H33O9P |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | triethyl 3-diethoxyphosphorylpentane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)CCC(CCC(=O)OCC)(C(=O)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H33O9P/c1-6-23-15(19)11-13-18(17(21)25-8-3,14-12-16(20)24-7-2)28(22,26-9-4)27-10-5/h6-14H2,1-5H3 |
| InChIKey | GHBAGBHXNAWKQU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|