C32H21BBr3F2O2+ — CID 158117982
1-(3-bromo-5-fluorophenyl)naphthalene;1,3-dibromo-5-fluorobenzene;2H-naphthalen-2-ylium-1-ylboronic acid (PubChem CID 158117982) has the molecular formula C32H21BBr3F2O2+ and a molecular weight of 726.04 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)naphthalene;1,3-dibromo-5-fluorobenzene;2H-naphthalen-2-ylium-1-ylboronic acid.
| Compound Name | 1-(3-bromo-5-fluorophenyl)naphthalene;1,3-dibromo-5-fluorobenzene;2H-naphthalen-2-ylium-1-ylboronic acid |
|---|---|
| PubChem CID | 158117982 |
| Molecular Formula | C32H21BBr3F2O2+ |
| Molecular Weight | 726.04 g/mol |
| Exact Mass | 722.91 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)naphthalene;1,3-dibromo-5-fluorobenzene;2H-naphthalen-2-ylium-1-ylboronic acid |
| SMILES | Fc1cc(Br)cc(-c2cccc3ccccc23)c1.Fc1cc(Br)cc(Br)c1.OB(O)C1=[C+]C=Cc2ccccc21 |
| InChI | InChI=1S/C16H10BrF.C10H8BO2.C6H3Br2F/c17-13-8-12(9-14(18)10-13)16-7-3-5-11-4-1-2-6-15(11)16;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;7-4-1-5(8)3-6(9)2-4/h1-10H;1-6,12-13H;1-3H/q;+1; |
| InChIKey | FRGHJRGFWWUKOL-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.04 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|