C9H12O2 — CID 15811828
2-but-3-ynyl-2-ethenyl-1,3-dioxolane (PubChem CID 15811828) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-but-3-ynyl-2-ethenyl-1,3-dioxolane.
| Compound Name | 2-but-3-ynyl-2-ethenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 15811828 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-but-3-ynyl-2-ethenyl-1,3-dioxolane |
| SMILES | C#CCCC1(C=C)OCCO1 |
| InChI | InChI=1S/C9H12O2/c1-3-5-6-9(4-2)10-7-8-11-9/h1,4H,2,5-8H2 |
| InChIKey | DZQLOICNGBBUKN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|