About 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine
2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine (PubChem CID 158118535) has the molecular formula C16H20F2N2O2
and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine |
| PubChem CID | 158118535 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine |
| SMILES | CNC.COc1ccccc1OCc1ccc(C(F)F)nc1 |
| InChI | InChI=1S/C14H13F2NO2.C2H7N/c1-18-12-4-2-3-5-13(12)19-9-10-6-7-11(14(15)16)17-8-10;1-3-2/h2-8,14H,9H2,1H3;3H,1-2H3 |
| InChIKey | FRIAGLLAPJSBDQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine?
The IUPAC name of 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine (CID 158118535) is 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine.
What is the SMILES notation for 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine?
The canonical SMILES for 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine is CNC.COc1ccccc1OCc1ccc(C(F)F)nc1.
What is the InChIKey of 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine?
The InChIKey is FRIAGLLAPJSBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2.C2H7N/c1-18-12-4-2-3-5-13(12)19-9-10-6-7-11(14(15)16)17-8-10;1-3-2/h2-8,14H,9H2,1H3;3H,1-2H3.
What are the key properties of 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine?
2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine has a molecular weight of 310.34 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-5-[(2-methoxyphenoxy)methyl]pyridine;N-methylmethanamine is sourced from PubChem (CID 158118535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).