C19H21NO4 — CID 15811875
ethyl 2-benzyl-1,6-dioxo-3,4,7,8-tetrahydroisoquinoline-8a-carboxylate (PubChem CID 15811875) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 2-benzyl-1,6-dioxo-3,4,7,8-tetrahydroisoquinoline-8a-carboxylate.
| Compound Name | ethyl 2-benzyl-1,6-dioxo-3,4,7,8-tetrahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15811875 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethyl 2-benzyl-1,6-dioxo-3,4,7,8-tetrahydroisoquinoline-8a-carboxylate |
| SMILES | CCOC(=O)C12CCC(=O)C=C1CCN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C19H21NO4/c1-2-24-18(23)19-10-8-16(21)12-15(19)9-11-20(17(19)22)13-14-6-4-3-5-7-14/h3-7,12H,2,8-11,13H2,1H3 |
| InChIKey | YGUFEUSWVNDUKC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|