About acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate
acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate (PubChem CID 158119502) has the molecular formula C12H20O10
and a molecular weight of 324.28 g/mol. Its IUPAC name is acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate.
Molecular Properties
| Compound Name | acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate |
| PubChem CID | 158119502 |
| Molecular Formula | C12H20O10 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate |
| SMILES | CC(=O)OC(C)=O.CC(=O)OCO.CC(=O)OCOC(C)=O |
| InChI | InChI=1S/C5H8O4.C4H6O3.C3H6O3/c1-4(6)8-3-9-5(2)7;1-3(5)7-4(2)6;1-3(5)6-2-4/h3H2,1-2H3;1-2H3;4H,2H2,1H3 |
| InChIKey | FRKVENIBJBDBCV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate?
The IUPAC name of acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate (CID 158119502) is acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate.
What is the SMILES notation for acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate?
The canonical SMILES for acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate is CC(=O)OC(C)=O.CC(=O)OCO.CC(=O)OCOC(C)=O.
What is the InChIKey of acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate?
The InChIKey is FRKVENIBJBDBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.C4H6O3.C3H6O3/c1-4(6)8-3-9-5(2)7;1-3(5)7-4(2)6;1-3(5)6-2-4/h3H2,1-2H3;1-2H3;4H,2H2,1H3.
What are the key properties of acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate?
acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate has a molecular weight of 324.28 g/mol, XLogP of -0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;acetyloxymethyl acetate;hydroxymethyl acetate is sourced from PubChem (CID 158119502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).