About [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid
[5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid (PubChem CID 158120575) has the molecular formula C11H15BF2O2
and a molecular weight of 228.05 g/mol. Its IUPAC name is [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid.
Molecular Properties
| Compound Name | [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid |
| PubChem CID | 158120575 |
| Molecular Formula | C11H15BF2O2 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid |
| SMILES | CC(C)(C)Cc1cc(B(O)O)c(F)cc1F |
| InChI | InChI=1S/C11H15BF2O2/c1-11(2,3)6-7-4-8(12(15)16)10(14)5-9(7)13/h4-5,15-16H,6H2,1-3H3 |
| InChIKey | GZZINGIBQZRQTB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid?
The IUPAC name of [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid (CID 158120575) is [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid.
What is the SMILES notation for [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid?
The canonical SMILES for [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid is CC(C)(C)Cc1cc(B(O)O)c(F)cc1F.
What is the InChIKey of [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid?
The InChIKey is GZZINGIBQZRQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BF2O2/c1-11(2,3)6-7-4-8(12(15)16)10(14)5-9(7)13/h4-5,15-16H,6H2,1-3H3.
What are the key properties of [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid?
[5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid has a molecular weight of 228.05 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-dimethylpropyl)-2,4-difluorophenyl]boronic acid is sourced from PubChem (CID 158120575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).