About tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid
tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid (PubChem CID 158121025) has the molecular formula C16H30N2O5
and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid |
| PubChem CID | 158121025 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)CC1.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C10H19NO3.C6H11NO2/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;8-6(9)7-4-2-1-3-5-7/h8,12H,4-7H2,1-3H3;1-5H2,(H,8,9) |
| InChIKey | FRPLIKGBQOETDB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid?
The IUPAC name of tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid (CID 158121025) is tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid.
What is the SMILES notation for tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid?
The canonical SMILES for tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid is CC(C)(C)OC(=O)N1CCC(O)CC1.O=C(O)N1CCCCC1.
What is the InChIKey of tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid?
The InChIKey is FRPLIKGBQOETDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.C6H11NO2/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;8-6(9)7-4-2-1-3-5-7/h8,12H,4-7H2,1-3H3;1-5H2,(H,8,9).
What are the key properties of tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid?
tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid has a molecular weight of 330.43 g/mol, XLogP of 2.53, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidine-1-carboxylic acid is sourced from PubChem (CID 158121025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).