C21H29NO — CID 158122344
N-[2-(3H-inden-1-yl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide (PubChem CID 158122344) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[2-(3H-inden-1-yl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide.
| Compound Name | N-[2-(3H-inden-1-yl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 158122344 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-[2-(3H-inden-1-yl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide |
| SMILES | CC1CCCC(C)(C)C1C(=O)NCCC1=CCc2ccccc21 |
| InChI | InChI=1S/C21H29NO/c1-15-7-6-13-21(2,3)19(15)20(23)22-14-12-17-11-10-16-8-4-5-9-18(16)17/h4-5,8-9,11,15,19H,6-7,10,12-14H2,1-3H3,(H,22,23) |
| InChIKey | OOFIXLLESTWHDY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |