1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide

C10H18BrN — CID 15812374

IUPAC1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide
SMILESC=CC[N+]1(CC=C)CCCC1.[Br-]
InChIInChI=1S/C10H18N.BrH/c1-3-7-11(8-4-2)9-5-6-10-11;/h3-4H,1-2,5-10H2;1H/q+1;/p-1
InChIKeySKQMFJIXLDJWPM-UHFFFAOYSA-M
MW232.16 g/mol
LogP-1.03
Rot. Bonds4

About 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide

1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide (PubChem CID 15812374) has the molecular formula C10H18BrN and a molecular weight of 232.16 g/mol. Its IUPAC name is 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide.

Molecular Properties

Compound Name1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide
PubChem CID15812374
Molecular FormulaC10H18BrN
Molecular Weight232.16 g/mol
Exact Mass231.06
IUPAC Name1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide
SMILESC=CC[N+]1(CC=C)CCCC1.[Br-]
InChIInChI=1S/C10H18N.BrH/c1-3-7-11(8-4-2)9-5-6-10-11;/h3-4H,1-2,5-10H2;1H/q+1;/p-1
InChIKeySKQMFJIXLDJWPM-UHFFFAOYSA-M
XLogP-1.03
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.16
LogP ≤ 5-1.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide?
The IUPAC name of 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide (CID 15812374) is 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide.
What is the SMILES notation for 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide?
The canonical SMILES for 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide is C=CC[N+]1(CC=C)CCCC1.[Br-].
What is the InChIKey of 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide?
The InChIKey is SKQMFJIXLDJWPM-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18N.BrH/c1-3-7-11(8-4-2)9-5-6-10-11;/h3-4H,1-2,5-10H2;1H/q+1;/p-1.
What are the key properties of 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide?
1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide has a molecular weight of 232.16 g/mol, XLogP of -1.03, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(prop-2-enyl)pyrrolidin-1-ium bromide is sourced from PubChem (CID 15812374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).