About [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid
[2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 158124714) has the molecular formula C18H24O9
and a molecular weight of 384.38 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid |
| PubChem CID | 158124714 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C14H18O7.C4H6O2/c1-4-11(16)19-8-14(7-15,9-20-12(17)5-2)10-21-13(18)6-3;1-3(2)4(5)6/h4-6,15H,1-3,7-10H2;1H2,2H3,(H,5,6) |
| InChIKey | FSAHIMVAHCLFFI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid?
The IUPAC name of [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid (CID 158124714) is [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid.
What is the SMILES notation for [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid?
The canonical SMILES for [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C.
What is the InChIKey of [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid?
The InChIKey is FSAHIMVAHCLFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O7.C4H6O2/c1-4-11(16)19-8-14(7-15,9-20-12(17)5-2)10-21-13(18)6-3;1-3(2)4(5)6/h4-6,15H,1-3,7-10H2;1H2,2H3,(H,5,6).
What are the key properties of [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid?
[2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid has a molecular weight of 384.38 g/mol, XLogP of 0.80, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 158124714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).