About 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol
3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol (PubChem CID 158125084) has the molecular formula C26H32N2O4
and a molecular weight of 436.55 g/mol. Its IUPAC name is 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol.
Molecular Properties
| Compound Name | 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol |
| PubChem CID | 158125084 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol |
| SMILES | CC1CC(O)C1.Oc1cccnc1.c1ccc(COC2CC(Oc3ccncc3)C2)cc1 |
| InChI | InChI=1S/C16H17NO2.C5H5NO.C5H10O/c1-2-4-13(5-3-1)12-18-15-10-16(11-15)19-14-6-8-17-9-7-14;7-5-2-1-3-6-4-5;1-4-2-5(6)3-4/h1-9,15-16H,10-12H2;1-4,7H;4-6H,2-3H2,1H3 |
| InChIKey | FSBLMRZONPRIHX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol?
The IUPAC name of 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol (CID 158125084) is 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol.
What is the SMILES notation for 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol?
The canonical SMILES for 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol is CC1CC(O)C1.Oc1cccnc1.c1ccc(COC2CC(Oc3ccncc3)C2)cc1.
What is the InChIKey of 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol?
The InChIKey is FSBLMRZONPRIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2.C5H5NO.C5H10O/c1-2-4-13(5-3-1)12-18-15-10-16(11-15)19-14-6-8-17-9-7-14;7-5-2-1-3-6-4-5;1-4-2-5(6)3-4/h1-9,15-16H,10-12H2;1-4,7H;4-6H,2-3H2,1H3.
What are the key properties of 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol?
3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol has a molecular weight of 436.55 g/mol, XLogP of 4.77, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclobutan-1-ol;4-(3-phenylmethoxycyclobutyl)oxypyridine;pyridin-3-ol is sourced from PubChem (CID 158125084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).