C20H12F3N7O4 — CID 158125089
2-(3,5-difluoro-2-nitrophenyl)pyrimidine;5-fluoro-2-nitro-3-pyrimidin-2-ylaniline (PubChem CID 158125089) has the molecular formula C20H12F3N7O4 and a molecular weight of 471.36 g/mol. Its IUPAC name is 2-(3,5-difluoro-2-nitrophenyl)pyrimidine;5-fluoro-2-nitro-3-pyrimidin-2-ylaniline.
| Compound Name | 2-(3,5-difluoro-2-nitrophenyl)pyrimidine;5-fluoro-2-nitro-3-pyrimidin-2-ylaniline |
|---|---|
| PubChem CID | 158125089 |
| Molecular Formula | C20H12F3N7O4 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 2-(3,5-difluoro-2-nitrophenyl)pyrimidine;5-fluoro-2-nitro-3-pyrimidin-2-ylaniline |
| SMILES | Nc1cc(F)cc(-c2ncccn2)c1[N+](=O)[O-].O=[N+]([O-])c1c(F)cc(F)cc1-c1ncccn1 |
| InChI | InChI=1S/C10H5F2N3O2.C10H7FN4O2/c2*11-6-4-7(10-13-2-1-3-14-10)9(15(16)17)8(12)5-6/h1-5H;1-5H,12H2 |
| InChIKey | FSBMCMBIRXGSSE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|