C22H24F6N2O2 — CID 158126167
cis-(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine;cis-(1S,3R)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine (PubChem CID 158126167) has the molecular formula C22H24F6N2O2 and a molecular weight of 462.43 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine;cis-(1S,3R)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine.
| Compound Name | cis-(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine;cis-(1S,3R)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 158126167 |
| Molecular Formula | C22H24F6N2O2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | cis-(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine;cis-(1S,3R)-3-(3,4,5-trifluorophenoxy)cyclopentan-1-amine |
| SMILES | N[C@@H]1CC[C@H](Oc2cc(F)c(F)c(F)c2)C1.N[C@H]1CC[C@@H](Oc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/2C11H12F3NO/c2*12-9-4-8(5-10(13)11(9)14)16-7-2-1-6(15)3-7/h2*4-7H,1-3,15H2/t2*6-,7+/m10/s1 |
| InChIKey | FSEWJOTUMMSNFV-RMHGRBOHSA-N |
| XLogP | 4.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|