C33H52O4Si2 — CID 15812715
(1R,2S,4S,5E,6R,8S,10R,14S)-5-benzylidene-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,14-dimethyl-6-trimethylsilyloxy-15-oxatetracyclo[6.6.1.01,10.02,6]pentadecan-13-one (PubChem CID 15812715) has the molecular formula C33H52O4Si2 and a molecular weight of 568.95 g/mol. Its IUPAC name is (1R,2S,4S,5E,6R,8S,10R,14S)-5-benzylidene-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,14-dimethyl-6-trimethylsilyloxy-15-oxatetracyclo[6.6.1.01,10.02,6]pentadecan-13-one.
| Compound Name | (1R,2S,4S,5E,6R,8S,10R,14S)-5-benzylidene-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,14-dimethyl-6-trimethylsilyloxy-15-oxatetracyclo[6.6.1.01,10.02,6]pentadecan-13-one |
|---|---|
| PubChem CID | 15812715 |
| Molecular Formula | C33H52O4Si2 |
| Molecular Weight | 568.95 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | (1R,2S,4S,5E,6R,8S,10R,14S)-5-benzylidene-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,14-dimethyl-6-trimethylsilyloxy-15-oxatetracyclo[6.6.1.01,10.02,6]pentadecan-13-one |
| SMILES | C[C@@H]1C(=O)CC[C@@H]2C[C@@]3(CO[Si](C)(C)C(C)(C)C)C[C@]4(O[Si](C)(C)C)/C(=C/c5ccccc5)[C@@H](C)C[C@H]4[C@]21O3 |
| InChI | InChI=1S/C33H52O4Si2/c1-23-18-29-32(37-38(6,7)8,27(23)19-25-14-12-11-13-15-25)21-31(22-35-39(9,10)30(3,4)5)20-26-16-17-28(34)24(2)33(26,29)36-31/h11-15,19,23-24,26,29H,16-18,20-22H2,1-10H3/b27-19+/t23-,24+,26+,29+,31-,32-,33+/m0/s1 |
| InChIKey | NISOKYNKVHQIIY-NHUAVRMVSA-N |
| XLogP | 8.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.95 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|