C72H69F6N9O9 — CID 158127412
8-[1-(3,5-difluorophenoxy)ethyl]-2-(3,6-dihydro-2H-pyran-4-yl)-N,N-dimethylquinoxaline-6-carboxamide (PubChem CID 158127412) has the molecular formula C72H69F6N9O9 and a molecular weight of 1318.39 g/mol. Its IUPAC name is 8-[1-(3,5-difluorophenoxy)ethyl]-2-(3,6-dihydro-2H-pyran-4-yl)-N,N-dimethylquinoxaline-6-carboxamide.
| Compound Name | 8-[1-(3,5-difluorophenoxy)ethyl]-2-(3,6-dihydro-2H-pyran-4-yl)-N,N-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 158127412 |
| Molecular Formula | C72H69F6N9O9 |
| Molecular Weight | 1318.39 g/mol |
| Exact Mass | 1317.51 |
| IUPAC Name | 8-[1-(3,5-difluorophenoxy)ethyl]-2-(3,6-dihydro-2H-pyran-4-yl)-N,N-dimethylquinoxaline-6-carboxamide |
| SMILES | CC(Oc1cc(F)cc(F)c1)c1cc(C(=O)N(C)C)cc2ncc(C3=CCOCC3)nc12.CC(Oc1cc(F)cc(F)c1)c1cc(C(=O)N(C)C)cc2ncc(C3=CCOCC3)nc12.CC(Oc1cc(F)cc(F)c1)c1cc(C(=O)N(C)C)cc2ncc(C3=CCOCC3)nc12 |
| InChI | InChI=1S/3C24H23F2N3O3/c3*1-14(32-19-11-17(25)10-18(26)12-19)20-8-16(24(30)29(2)3)9-21-23(20)28-22(13-27-21)15-4-6-31-7-5-15/h3*4,8-14H,5-7H2,1-3H3 |
| InChIKey | FSIVFIXMFSYKJG-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 193.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1318.39 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |