C11H12FNO4 — CID 158127425
1-[(2R,3R,4R)-3-fluoro-4-hydroxy-3-methyl-5-methylideneoxolan-2-yl]pyridine-2,4-dione (PubChem CID 158127425) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-3-fluoro-4-hydroxy-3-methyl-5-methylideneoxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R)-3-fluoro-4-hydroxy-3-methyl-5-methylideneoxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 158127425 |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 1-[(2R,3R,4R)-3-fluoro-4-hydroxy-3-methyl-5-methylideneoxolan-2-yl]pyridine-2,4-dione |
| SMILES | C=C1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C11H12FNO4/c1-6-9(16)11(2,12)10(17-6)13-4-3-7(14)5-8(13)15/h3-4,9-10,16H,1,5H2,2H3/t9-,10-,11-/m1/s1 |
| InChIKey | JELWXRNKEWOUSD-GMTAPVOTSA-N |
| XLogP | 0.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|