C23H33BrN3O3+ — CID 158129448
tert-butyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate;hydrobromide (PubChem CID 158129448) has the molecular formula C23H33BrN3O3+ and a molecular weight of 479.44 g/mol. Its IUPAC name is tert-butyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate;hydrobromide.
| Compound Name | tert-butyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate;hydrobromide |
|---|---|
| PubChem CID | 158129448 |
| Molecular Formula | C23H33BrN3O3+ |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | tert-butyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate;hydrobromide |
| SMILES | Br.Cc1cccc(C(=O)OC(C)(C)C)c1NC(=O)C[n+]1cccn1C1CCCCC1 |
| InChI | InChI=1S/C23H31N3O3.BrH/c1-17-10-8-13-19(22(28)29-23(2,3)4)21(17)24-20(27)16-25-14-9-15-26(25)18-11-6-5-7-12-18;/h8-10,13-15,18H,5-7,11-12,16H2,1-4H3;1H/p+1 |
| InChIKey | NVPMZGNPZWBBLX-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|