About formyl fluoride;1,2,4-trifluorobenzene
formyl fluoride;1,2,4-trifluorobenzene (PubChem CID 158131770) has the molecular formula C7H4F4O
and a molecular weight of 180.10 g/mol. Its IUPAC name is formyl fluoride;1,2,4-trifluorobenzene.
Molecular Properties
| Compound Name | formyl fluoride;1,2,4-trifluorobenzene |
| PubChem CID | 158131770 |
| Molecular Formula | C7H4F4O |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | formyl fluoride;1,2,4-trifluorobenzene |
| SMILES | Fc1ccc(F)c(F)c1.O=CF |
| InChI | InChI=1S/C6H3F3.CHFO/c7-4-1-2-5(8)6(9)3-4;2-1-3/h1-3H;1H |
| InChIKey | FSWACEGDLQXFRZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze formyl fluoride;1,2,4-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl fluoride;1,2,4-trifluorobenzene?
The IUPAC name of formyl fluoride;1,2,4-trifluorobenzene (CID 158131770) is formyl fluoride;1,2,4-trifluorobenzene.
What is the SMILES notation for formyl fluoride;1,2,4-trifluorobenzene?
The canonical SMILES for formyl fluoride;1,2,4-trifluorobenzene is Fc1ccc(F)c(F)c1.O=CF.
What is the InChIKey of formyl fluoride;1,2,4-trifluorobenzene?
The InChIKey is FSWACEGDLQXFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3.CHFO/c7-4-1-2-5(8)6(9)3-4;2-1-3/h1-3H;1H.
What are the key properties of formyl fluoride;1,2,4-trifluorobenzene?
formyl fluoride;1,2,4-trifluorobenzene has a molecular weight of 180.10 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formyl fluoride;1,2,4-trifluorobenzene is sourced from PubChem (CID 158131770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).