C26H28ClF3N2O5 — CID 158132074
1-[(2R,4R)-6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl]-2-[4-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-1-bicyclo[2.2.2]octanyl]ethanone (PubChem CID 158132074) has the molecular formula C26H28ClF3N2O5 and a molecular weight of 540.97 g/mol. Its IUPAC name is 1-[(2R,4R)-6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl]-2-[4-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-1-bicyclo[2.2.2]octanyl]ethanone.
| Compound Name | 1-[(2R,4R)-6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl]-2-[4-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-1-bicyclo[2.2.2]octanyl]ethanone |
|---|---|
| PubChem CID | 158132074 |
| Molecular Formula | C26H28ClF3N2O5 |
| Molecular Weight | 540.97 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-[(2R,4R)-6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl]-2-[4-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-1-bicyclo[2.2.2]octanyl]ethanone |
| SMILES | O=C(CC12CCC(c3nnc(C4CC(OC(F)(F)F)C4)o3)(CC1)CC2)[C@H]1C[C@@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C26H28ClF3N2O5/c27-15-1-2-20-17(11-15)18(33)12-21(35-20)19(34)13-24-3-6-25(7-4-24,8-5-24)23-32-31-22(36-23)14-9-16(10-14)37-26(28,29)30/h1-2,11,14,16,18,21,33H,3-10,12-13H2/t14?,16?,18-,21-,24?,25?/m1/s1 |
| InChIKey | FSWZTDXPQYLJPE-MNDPHDHGSA-N |
| XLogP | 5.94 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |