C10H24O8S2 — CID 158132781
ethanol;3-ethoxypropane-1-sulfonic acid;oxathiolane 2,2-dioxide (PubChem CID 158132781) has the molecular formula C10H24O8S2 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethanol;3-ethoxypropane-1-sulfonic acid;oxathiolane 2,2-dioxide.
| Compound Name | ethanol;3-ethoxypropane-1-sulfonic acid;oxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 158132781 |
| Molecular Formula | C10H24O8S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethanol;3-ethoxypropane-1-sulfonic acid;oxathiolane 2,2-dioxide |
| SMILES | CCO.CCOCCCS(=O)(=O)O.O=S1(=O)CCCO1 |
| InChI | InChI=1S/C5H12O4S.C3H6O3S.C2H6O/c1-2-9-4-3-5-10(6,7)8;4-7(5)3-1-2-6-7;1-2-3/h2-5H2,1H3,(H,6,7,8);1-3H2;3H,2H2,1H3 |
| InChIKey | FSZDYJNRVKMHCG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|