C9H12N4 — CID 15813434
(1S,4S)-2-pyrazin-2-yl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 15813434) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1S,4S)-2-pyrazin-2-yl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-pyrazin-2-yl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 15813434 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (1S,4S)-2-pyrazin-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | c1cnc(N2C[C@@H]3C[C@H]2CN3)cn1 |
| InChI | InChI=1S/C9H12N4/c1-2-11-9(5-10-1)13-6-7-3-8(13)4-12-7/h1-2,5,7-8,12H,3-4,6H2/t7-,8-/m0/s1 |
| InChIKey | HTNKLICVDYQOGZ-YUMQZZPRSA-N |
| XLogP | 0.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |