About CID 158135551
CID 158135551 (PubChem CID 158135551) has the molecular formula C48H52BN8O10S2
and a molecular weight of 975.94 g/mol.
Molecular Properties
| Compound Name | CID 158135551 |
| PubChem CID | 158135551 |
| Molecular Formula | C48H52BN8O10S2 |
| Molecular Weight | 975.94 g/mol |
| Exact Mass | 975.33 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cnc(N2CCO[C@H](CNS(=O)(=O)c3ccc(-c4ccccc4)cc3)C2)nc1.CCOC(=O)c1cnc(N2CCO[C@H](CNS(=O)(=O)c3ccc(-c4ccccc4)cc3)C2)nc1.[B] |
| InChI | InChI=1S/2C24H26N4O5S.B/c2*1-2-32-23(29)20-14-25-24(26-15-20)28-12-13-33-21(17-28)16-27-34(30,31)22-10-8-19(9-11-22)18-6-4-3-5-7-18;/h2*3-11,14-15,21,27H,2,12-13,16-17H2,1H3;/t2*21-;/m11./s1 |
| InChIKey | WMUMTCKARUQACT-ITEXDBGESA-N |
| XLogP | 4.63 |
| TPSA | 221.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 975.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158135551 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158135551?
The IUPAC name of CID 158135551 (CID 158135551) is not available.
What is the SMILES notation for CID 158135551?
The canonical SMILES for CID 158135551 is CCOC(=O)c1cnc(N2CCO[C@H](CNS(=O)(=O)c3ccc(-c4ccccc4)cc3)C2)nc1.CCOC(=O)c1cnc(N2CCO[C@H](CNS(=O)(=O)c3ccc(-c4ccccc4)cc3)C2)nc1.[B].
What is the InChIKey of CID 158135551?
The InChIKey is WMUMTCKARUQACT-ITEXDBGESA-N. The full InChI is InChI=1S/2C24H26N4O5S.B/c2*1-2-32-23(29)20-14-25-24(26-15-20)28-12-13-33-21(17-28)16-27-34(30,31)22-10-8-19(9-11-22)18-6-4-3-5-7-18;/h2*3-11,14-15,21,27H,2,12-13,16-17H2,1H3;/t2*21-;/m11./s1.
What are the key properties of CID 158135551?
CID 158135551 has a molecular weight of 975.94 g/mol, XLogP of 4.63, 16 rotatable bonds, 2 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158135551 is sourced from PubChem (CID 158135551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).