About carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate
carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate (PubChem CID 158135585) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate.
Molecular Properties
| Compound Name | carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate |
| PubChem CID | 158135585 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate |
| SMILES | CCOC(=O)/C(=C/Nc1cccc(C)c1OC)CC.O=C=O |
| InChI | InChI=1S/C15H21NO3.CO2/c1-5-12(15(17)19-6-2)10-16-13-9-7-8-11(3)14(13)18-4;2-1-3/h7-10,16H,5-6H2,1-4H3;/b12-10+; |
| InChIKey | FTHPEYUBVSZKOS-VHPXAQPISA-N |
| XLogP | 2.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate?
The IUPAC name of carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate (CID 158135585) is carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate.
What is the SMILES notation for carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate?
The canonical SMILES for carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate is CCOC(=O)/C(=C/Nc1cccc(C)c1OC)CC.O=C=O.
What is the InChIKey of carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate?
The InChIKey is FTHPEYUBVSZKOS-VHPXAQPISA-N. The full InChI is InChI=1S/C15H21NO3.CO2/c1-5-12(15(17)19-6-2)10-16-13-9-7-8-11(3)14(13)18-4;2-1-3/h7-10,16H,5-6H2,1-4H3;/b12-10+;.
What are the key properties of carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate?
carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate has a molecular weight of 307.35 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;ethyl (2E)-2-[(2-methoxy-3-methylanilino)methylidene]butanoate is sourced from PubChem (CID 158135585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).