C27H31N2O4P+2 — CID 158137042
2-[4-[(E)-2-[2,5-dimethyl-4-[(E)-2-[1-(3-oxopropyl)pyridin-1-ium-4-yl]ethenyl]phenyl]ethenyl]pyridin-1-ium-1-yl]ethylphosphonic acid (PubChem CID 158137042) has the molecular formula C27H31N2O4P+2 and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[4-[(E)-2-[2,5-dimethyl-4-[(E)-2-[1-(3-oxopropyl)pyridin-1-ium-4-yl]ethenyl]phenyl]ethenyl]pyridin-1-ium-1-yl]ethylphosphonic acid.
| Compound Name | 2-[4-[(E)-2-[2,5-dimethyl-4-[(E)-2-[1-(3-oxopropyl)pyridin-1-ium-4-yl]ethenyl]phenyl]ethenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 158137042 |
| Molecular Formula | C27H31N2O4P+2 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[4-[(E)-2-[2,5-dimethyl-4-[(E)-2-[1-(3-oxopropyl)pyridin-1-ium-4-yl]ethenyl]phenyl]ethenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
| SMILES | Cc1cc(/C=C/c2cc[n+](CCP(=O)(O)O)cc2)c(C)cc1/C=C/c1cc[n+](CCC=O)cc1 |
| InChI | InChI=1S/C27H29N2O4P/c1-22-21-27(7-5-25-10-15-29(16-11-25)17-19-34(31,32)33)23(2)20-26(22)6-4-24-8-13-28(14-9-24)12-3-18-30/h4-11,13-16,18,20-21H,3,12,17,19H2,1-2H3/p+2/b6-4+,7-5+ |
| InChIKey | CMCVRJFXAPYPAX-YDFGWWAZSA-P |
| XLogP | 3.99 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|