C28H37F2N3O2 — CID 158137195
(3R)-3-[2-(1,1-difluoroethyl)phenyl]-3-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]prop-1-en-2-ol (PubChem CID 158137195) has the molecular formula C28H37F2N3O2 and a molecular weight of 485.62 g/mol. Its IUPAC name is (3R)-3-[2-(1,1-difluoroethyl)phenyl]-3-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]prop-1-en-2-ol.
| Compound Name | (3R)-3-[2-(1,1-difluoroethyl)phenyl]-3-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 158137195 |
| Molecular Formula | C28H37F2N3O2 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (3R)-3-[2-(1,1-difluoroethyl)phenyl]-3-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
| SMILES | C=C(O)[C@@H](c1ccccc1C(C)(F)F)N1CC[C@@H](OCCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C28H37F2N3O2/c1-20(34)26(24-11-5-6-12-25(24)28(2,29)30)33-17-15-23(19-33)35-18-7-3-4-10-22-14-13-21-9-8-16-31-27(21)32-22/h5-6,11-14,23,26,34H,1,3-4,7-10,15-19H2,2H3,(H,31,32)/t23-,26+/m1/s1 |
| InChIKey | FNAZVRKRKVMPBS-BVAGGSTKSA-N |
| XLogP | 6.17 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|