About 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide
2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide (PubChem CID 158137216) has the molecular formula C10H9Br3N2O4
and a molecular weight of 460.90 g/mol. Its IUPAC name is 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide.
Molecular Properties
| Compound Name | 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide |
| PubChem CID | 158137216 |
| Molecular Formula | C10H9Br3N2O4 |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 457.81 |
| IUPAC Name | 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(Br)CBr.O=C(CBr)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7BrN2O3.C2H2Br2O/c9-5-8(12)10-6-3-1-2-4-7(6)11(13)14;3-1-2(4)5/h1-4H,5H2,(H,10,12);1H2 |
| InChIKey | FTMIFEHTZBSWRI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide?
The IUPAC name of 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide (CID 158137216) is 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide.
What is the SMILES notation for 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide?
The canonical SMILES for 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide is O=C(Br)CBr.O=C(CBr)Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide?
The InChIKey is FTMIFEHTZBSWRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O3.C2H2Br2O/c9-5-8(12)10-6-3-1-2-4-7(6)11(13)14;3-1-2(4)5/h1-4H,5H2,(H,10,12);1H2.
What are the key properties of 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide?
2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide has a molecular weight of 460.90 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoacetyl bromide;2-bromo-N-(2-nitrophenyl)acetamide is sourced from PubChem (CID 158137216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).