C32H42N2O10 — CID 15813733
dimethyl 2,7,15,20-tetraoxo-3,19-dioxa-6,16-diazaheptacyclo[19.5.1.11,23.18,12.18,14.110,14.121,25]dotriacontane-5,17-dicarboxylate (PubChem CID 15813733) has the molecular formula C32H42N2O10 and a molecular weight of 614.69 g/mol. Its IUPAC name is dimethyl 2,7,15,20-tetraoxo-3,19-dioxa-6,16-diazaheptacyclo[19.5.1.11,23.18,12.18,14.110,14.121,25]dotriacontane-5,17-dicarboxylate.
| Compound Name | dimethyl 2,7,15,20-tetraoxo-3,19-dioxa-6,16-diazaheptacyclo[19.5.1.11,23.18,12.18,14.110,14.121,25]dotriacontane-5,17-dicarboxylate |
|---|---|
| PubChem CID | 15813733 |
| Molecular Formula | C32H42N2O10 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | dimethyl 2,7,15,20-tetraoxo-3,19-dioxa-6,16-diazaheptacyclo[19.5.1.11,23.18,12.18,14.110,14.121,25]dotriacontane-5,17-dicarboxylate |
| SMILES | COC(=O)C1COC(=O)C23CC4CC(C2)CC(C4)(C3)C(=O)OCC(C(=O)OC)NC(=O)C23CC4CC(CC(C4)(C2)C(=O)N1)C3 |
| InChI | InChI=1S/C32H42N2O10/c1-41-23(35)21-13-43-27(39)31-9-19-4-20(10-31)12-32(11-19,16-31)28(40)44-14-22(24(36)42-2)34-26(38)30-7-17-3-18(8-30)6-29(5-17,15-30)25(37)33-21/h17-22H,3-16H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | HEDPTTGCSPDVTQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|