C33H33ClN10OS2 — CID 158138439
N-(6-chloro-3-pyridinyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)pyrimidin-2-amine;4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 158138439) has the molecular formula C33H33ClN10OS2 and a molecular weight of 685.28 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)pyrimidin-2-amine;4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)pyrimidin-2-amine;4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 158138439 |
| Molecular Formula | C33H33ClN10OS2 |
| Molecular Weight | 685.28 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)pyrimidin-2-amine;4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | Cc1nc(-c2ccnc(Nc3ccc(Cl)nc3)n2)sc1C.Cc1nc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)sc1C |
| InChI | InChI=1S/C19H21N5OS.C14H12ClN5S/c1-13-14(2)26-18(21-13)17-7-8-20-19(23-17)22-15-3-5-16(6-4-15)24-9-11-25-12-10-24;1-8-9(2)21-13(18-8)11-5-6-16-14(20-11)19-10-3-4-12(15)17-7-10/h3-8H,9-12H2,1-2H3,(H,20,22,23);3-7H,1-2H3,(H,16,19,20) |
| InChIKey | FTQIYEJGQVOMJL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.28 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|