About (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate
(2,3,5,6-tetrafluorophenyl) 4-iodobenzoate (PubChem CID 15813866) has the molecular formula C13H5F4IO2
and a molecular weight of 396.08 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate.
Molecular Properties
| Compound Name | (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate |
| PubChem CID | 15813866 |
| Molecular Formula | C13H5F4IO2 |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H5F4IO2/c14-8-5-9(15)11(17)12(10(8)16)20-13(19)6-1-3-7(18)4-2-6/h1-5H |
| InChIKey | GOBNIPAGFFRMMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate?
The IUPAC name of (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate (CID 15813866) is (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate.
What is the SMILES notation for (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate?
The canonical SMILES for (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate is O=C(Oc1c(F)c(F)cc(F)c1F)c1ccc(I)cc1.
What is the InChIKey of (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate?
The InChIKey is GOBNIPAGFFRMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5F4IO2/c14-8-5-9(15)11(17)12(10(8)16)20-13(19)6-1-3-7(18)4-2-6/h1-5H.
What are the key properties of (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate?
(2,3,5,6-tetrafluorophenyl) 4-iodobenzoate has a molecular weight of 396.08 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5,6-tetrafluorophenyl) 4-iodobenzoate is sourced from PubChem (CID 15813866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).