C8H14N6S — CID 158139387
3,4-dimethyl-1,2,4-triazole;3,4-dimethyl-1H-1,2,4-triazole-5-thione (PubChem CID 158139387) has the molecular formula C8H14N6S and a molecular weight of 226.31 g/mol. Its IUPAC name is 3,4-dimethyl-1,2,4-triazole;3,4-dimethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3,4-dimethyl-1,2,4-triazole;3,4-dimethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 158139387 |
| Molecular Formula | C8H14N6S |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3,4-dimethyl-1,2,4-triazole;3,4-dimethyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1C.Cc1nncn1C |
| InChI | InChI=1S/C4H7N3S.C4H7N3/c1-3-5-6-4(8)7(3)2;1-4-6-5-3-7(4)2/h1-2H3,(H,6,8);3H,1-2H3 |
| InChIKey | FTTFGMYFMCMWEC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|