C32H33FN2O3 — CID 158140399
2-[4-[4-anilino-7-(hydroxymethyl)-3-propanoylquinolin-6-yl]-2-fluorophenyl]heptan-4-one (PubChem CID 158140399) has the molecular formula C32H33FN2O3 and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[4-[4-anilino-7-(hydroxymethyl)-3-propanoylquinolin-6-yl]-2-fluorophenyl]heptan-4-one.
| Compound Name | 2-[4-[4-anilino-7-(hydroxymethyl)-3-propanoylquinolin-6-yl]-2-fluorophenyl]heptan-4-one |
|---|---|
| PubChem CID | 158140399 |
| Molecular Formula | C32H33FN2O3 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 2-[4-[4-anilino-7-(hydroxymethyl)-3-propanoylquinolin-6-yl]-2-fluorophenyl]heptan-4-one |
| SMILES | CCCC(=O)CC(C)c1ccc(-c2cc3c(Nc4ccccc4)c(C(=O)CC)cnc3cc2CO)cc1F |
| InChI | InChI=1S/C32H33FN2O3/c1-4-9-24(37)14-20(3)25-13-12-21(15-29(25)33)26-17-27-30(16-22(26)19-36)34-18-28(31(38)5-2)32(27)35-23-10-7-6-8-11-23/h6-8,10-13,15-18,20,36H,4-5,9,14,19H2,1-3H3,(H,34,35) |
| InChIKey | JJFINSFFYGRWES-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |