About 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane
9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane (PubChem CID 158140657) has the molecular formula C32H28B2Br2
and a molecular weight of 594.01 g/mol. Its IUPAC name is 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane.
Molecular Properties
| Compound Name | 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane |
| PubChem CID | 158140657 |
| Molecular Formula | C32H28B2Br2 |
| Molecular Weight | 594.01 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane |
| SMILES | Brc1c2ccccc2c(Br)c2ccccc12.CB(C)c1c2ccccc2c(B(C)C)c2ccccc12 |
| InChI | InChI=1S/C18H20B2.C14H8Br2/c1-19(2)17-13-9-5-7-11-15(13)18(20(3)4)16-12-8-6-10-14(16)17;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h5-12H,1-4H3;1-8H |
| InChIKey | FTWYOHGXWSJSQE-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.01 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane?
The IUPAC name of 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane (CID 158140657) is 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane.
What is the SMILES notation for 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane?
The canonical SMILES for 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane is Brc1c2ccccc2c(Br)c2ccccc12.CB(C)c1c2ccccc2c(B(C)C)c2ccccc12.
What is the InChIKey of 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane?
The InChIKey is FTWYOHGXWSJSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20B2.C14H8Br2/c1-19(2)17-13-9-5-7-11-15(13)18(20(3)4)16-12-8-6-10-14(16)17;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h5-12H,1-4H3;1-8H.
What are the key properties of 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane?
9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane has a molecular weight of 594.01 g/mol, XLogP of 9.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dibromoanthracene;(10-dimethylboranylanthracen-9-yl)-dimethylborane is sourced from PubChem (CID 158140657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).