About 1H-benzimidazole;manganese
1H-benzimidazole;manganese (PubChem CID 158140840) has the molecular formula C7H6MnN2
and a molecular weight of 173.08 g/mol. Its IUPAC name is 1H-benzimidazole;manganese.
Molecular Properties
| Compound Name | 1H-benzimidazole;manganese |
| PubChem CID | 158140840 |
| Molecular Formula | C7H6MnN2 |
| Molecular Weight | 173.08 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | 1H-benzimidazole;manganese |
| SMILES | [Mn].c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.Mn/c1-2-4-7-6(3-1)8-5-9-7;/h1-5H,(H,8,9); |
| InChIKey | FTXMLXIUJVNFBF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.08 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzimidazole;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;manganese?
The IUPAC name of 1H-benzimidazole;manganese (CID 158140840) is 1H-benzimidazole;manganese.
What is the SMILES notation for 1H-benzimidazole;manganese?
The canonical SMILES for 1H-benzimidazole;manganese is [Mn].c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;manganese?
The InChIKey is FTXMLXIUJVNFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.Mn/c1-2-4-7-6(3-1)8-5-9-7;/h1-5H,(H,8,9);.
What are the key properties of 1H-benzimidazole;manganese?
1H-benzimidazole;manganese has a molecular weight of 173.08 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;manganese is sourced from PubChem (CID 158140840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).