C11H17ClO — CID 158141437
(2R,3S,5S)-2-chloro-2,3-dimethyl-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 158141437) has the molecular formula C11H17ClO and a molecular weight of 200.71 g/mol. Its IUPAC name is (2R,3S,5S)-2-chloro-2,3-dimethyl-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | (2R,3S,5S)-2-chloro-2,3-dimethyl-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 158141437 |
| Molecular Formula | C11H17ClO |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2R,3S,5S)-2-chloro-2,3-dimethyl-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@](C)(Cl)[C@@H](C)C1 |
| InChI | InChI=1S/C11H17ClO/c1-7(2)9-5-8(3)11(4,12)10(13)6-9/h8-9H,1,5-6H2,2-4H3/t8-,9-,11+/m0/s1 |
| InChIKey | GGRZCWGPQTUULD-ATZCPNFKSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|